C12H22N2O — CID 79669262
1-(4-ethylmorpholin-2-yl)-N-propylprop-2-yn-1-amine (PubChem CID 79669262) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-(4-ethylmorpholin-2-yl)-N-propylprop-2-yn-1-amine.
| Compound Name | 1-(4-ethylmorpholin-2-yl)-N-propylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 79669262 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1-(4-ethylmorpholin-2-yl)-N-propylprop-2-yn-1-amine |
| SMILES | C#CC(NCCC)C1CN(CC)CCO1 |
| InChI | InChI=1S/C12H22N2O/c1-4-7-13-11(5-2)12-10-14(6-3)8-9-15-12/h2,11-13H,4,6-10H2,1,3H3 |
| InChIKey | RYAUDYHVOMLSHW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|