C19H19NO2 — CID 796695
9-phenyl-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione (PubChem CID 796695) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 9-phenyl-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione.
| Compound Name | 9-phenyl-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 796695 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 9-phenyl-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccccc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C19H19NO2/c21-15-10-4-8-13-18(15)17(12-6-2-1-3-7-12)19-14(20-13)9-5-11-16(19)22/h1-3,6-7,17,20H,4-5,8-11H2 |
| InChIKey | OYPIMRRBVHIMLW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |