About 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde
4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde (PubChem CID 79670275) has the molecular formula C11H14O3S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde.
Molecular Properties
| Compound Name | 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde |
| PubChem CID | 79670275 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde |
| SMILES | Cc1cc(SCC(O)CO)ccc1C=O |
| InChI | InChI=1S/C11H14O3S/c1-8-4-11(3-2-9(8)5-12)15-7-10(14)6-13/h2-5,10,13-14H,6-7H2,1H3 |
| InChIKey | XBGWWPNDYSPDIA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde?
The IUPAC name of 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde (CID 79670275) is 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde.
What is the SMILES notation for 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde?
The canonical SMILES for 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde is Cc1cc(SCC(O)CO)ccc1C=O.
What is the InChIKey of 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde?
The InChIKey is XBGWWPNDYSPDIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3S/c1-8-4-11(3-2-9(8)5-12)15-7-10(14)6-13/h2-5,10,13-14H,6-7H2,1H3.
What are the key properties of 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde?
4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde has a molecular weight of 226.30 g/mol, XLogP of 1.25, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydroxypropylsulfanyl)-2-methylbenzaldehyde is sourced from PubChem (CID 79670275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).