About 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine
1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine (PubChem CID 79670328) has the molecular formula C17H31NO2
and a molecular weight of 281.44 g/mol. Its IUPAC name is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine.
Molecular Properties
| Compound Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine |
| PubChem CID | 79670328 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine |
| SMILES | CCCC1(CCC)CN(C2CCC3(CC2)OCCO3)C1 |
| InChI | InChI=1S/C17H31NO2/c1-3-7-16(8-4-2)13-18(14-16)15-5-9-17(10-6-15)19-11-12-20-17/h15H,3-14H2,1-2H3 |
| InChIKey | TXSIHEFZVXAEEW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine?
The IUPAC name of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine (CID 79670328) is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine.
What is the SMILES notation for 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine?
The canonical SMILES for 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine is CCCC1(CCC)CN(C2CCC3(CC2)OCCO3)C1.
What is the InChIKey of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine?
The InChIKey is TXSIHEFZVXAEEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO2/c1-3-7-16(8-4-2)13-18(14-16)15-5-9-17(10-6-15)19-11-12-20-17/h15H,3-14H2,1-2H3.
What are the key properties of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine?
1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine has a molecular weight of 281.44 g/mol, XLogP of 3.57, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dipropylazetidine is sourced from PubChem (CID 79670328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).