C11H13BrO3S — CID 79670715
1-(3-bromophenyl)-2-(2,3-dihydroxypropylsulfanyl)ethanone (PubChem CID 79670715) has the molecular formula C11H13BrO3S and a molecular weight of 305.19 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(2,3-dihydroxypropylsulfanyl)ethanone.
| Compound Name | 1-(3-bromophenyl)-2-(2,3-dihydroxypropylsulfanyl)ethanone |
|---|---|
| PubChem CID | 79670715 |
| Molecular Formula | C11H13BrO3S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 1-(3-bromophenyl)-2-(2,3-dihydroxypropylsulfanyl)ethanone |
| SMILES | O=C(CSCC(O)CO)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H13BrO3S/c12-9-3-1-2-8(4-9)11(15)7-16-6-10(14)5-13/h1-4,10,13-14H,5-7H2 |
| InChIKey | DYJHRNVTLMYUKQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |