About 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide
2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide (PubChem CID 79670744) has the molecular formula C12H24N2O3S
and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide |
| PubChem CID | 79670744 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide |
| SMILES | CC(C)NC(CSCC(O)CO)(C(N)=O)C1CC1 |
| InChI | InChI=1S/C12H24N2O3S/c1-8(2)14-12(11(13)17,9-3-4-9)7-18-6-10(16)5-15/h8-10,14-16H,3-7H2,1-2H3,(H2,13,17) |
| InChIKey | ZSHLBMOMJFIFMB-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide?
The IUPAC name of 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide (CID 79670744) is 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide.
What is the SMILES notation for 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide?
The canonical SMILES for 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide is CC(C)NC(CSCC(O)CO)(C(N)=O)C1CC1.
What is the InChIKey of 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide?
The InChIKey is ZSHLBMOMJFIFMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3S/c1-8(2)14-12(11(13)17,9-3-4-9)7-18-6-10(16)5-15/h8-10,14-16H,3-7H2,1-2H3,(H2,13,17).
What are the key properties of 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide?
2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide has a molecular weight of 276.40 g/mol, XLogP of -0.30, 9 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3-(2,3-dihydroxypropylsulfanyl)-2-(propan-2-ylamino)propanamide is sourced from PubChem (CID 79670744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).