C12H16OS — CID 79670956
1-[(3,5-dimethylphenyl)methylsulfanyl]propan-2-one (PubChem CID 79670956) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methylsulfanyl]propan-2-one.
| Compound Name | 1-[(3,5-dimethylphenyl)methylsulfanyl]propan-2-one |
|---|---|
| PubChem CID | 79670956 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methylsulfanyl]propan-2-one |
| SMILES | CC(=O)CSCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H16OS/c1-9-4-10(2)6-12(5-9)8-14-7-11(3)13/h4-6H,7-8H2,1-3H3 |
| InChIKey | RFIFKMPAYWCXCW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |