About 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol
3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol (PubChem CID 79671952) has the molecular formula C12H16O3S2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol |
| PubChem CID | 79671952 |
| Molecular Formula | C12H16O3S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol |
| SMILES | OCCC#Cc1csc(CSCC(O)CO)c1 |
| InChI | InChI=1S/C12H16O3S2/c13-4-2-1-3-10-5-12(17-7-10)9-16-8-11(15)6-14/h5,7,11,13-15H,2,4,6,8-9H2 |
| InChIKey | YJJXJYBVQQVJCE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol?
The IUPAC name of 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol (CID 79671952) is 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol.
What is the SMILES notation for 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol?
The canonical SMILES for 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol is OCCC#Cc1csc(CSCC(O)CO)c1.
What is the InChIKey of 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol?
The InChIKey is YJJXJYBVQQVJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3S2/c13-4-2-1-3-10-5-12(17-7-10)9-16-8-11(15)6-14/h5,7,11,13-15H,2,4,6,8-9H2.
What are the key properties of 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol?
3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol has a molecular weight of 272.39 g/mol, XLogP of 1.07, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]propane-1,2-diol is sourced from PubChem (CID 79671952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).