C8H13NO4S — CID 79673182
(2S)-1-prop-2-enylsulfonylpyrrolidine-2-carboxylic acid (PubChem CID 79673182) has the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. Its IUPAC name is (2S)-1-prop-2-enylsulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-prop-2-enylsulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79673182 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (2S)-1-prop-2-enylsulfonylpyrrolidine-2-carboxylic acid |
| SMILES | C=CCS(=O)(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C8H13NO4S/c1-2-6-14(12,13)9-5-3-4-7(9)8(10)11/h2,7H,1,3-6H2,(H,10,11)/t7-/m0/s1 |
| InChIKey | NVEXDUZKEQSGMI-ZETCQYMHSA-N |
| XLogP | 0.05 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|