About 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol
2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol (PubChem CID 79673929) has the molecular formula C8H14N2OS
and a molecular weight of 186.28 g/mol. Its IUPAC name is 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol |
| PubChem CID | 79673929 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol |
| SMILES | Cc1csc(CN(C)CCO)n1 |
| InChI | InChI=1S/C8H14N2OS/c1-7-6-12-8(9-7)5-10(2)3-4-11/h6,11H,3-5H2,1-2H3 |
| InChIKey | CKJOZULDNLDDGO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol?
The IUPAC name of 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol (CID 79673929) is 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol.
What is the SMILES notation for 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol?
The canonical SMILES for 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol is Cc1csc(CN(C)CCO)n1.
What is the InChIKey of 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol?
The InChIKey is CKJOZULDNLDDGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2OS/c1-7-6-12-8(9-7)5-10(2)3-4-11/h6,11H,3-5H2,1-2H3.
What are the key properties of 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol?
2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol has a molecular weight of 186.28 g/mol, XLogP of 0.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-[(4-methyl-1,3-thiazol-2-yl)methyl]amino]ethanol is sourced from PubChem (CID 79673929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).