C14H14N4O2 — CID 79674248
4-(5-amino-1H-indole-2-carbonyl)morpholine-2-carbonitrile (PubChem CID 79674248) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-(5-amino-1H-indole-2-carbonyl)morpholine-2-carbonitrile.
| Compound Name | 4-(5-amino-1H-indole-2-carbonyl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 79674248 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 4-(5-amino-1H-indole-2-carbonyl)morpholine-2-carbonitrile |
| SMILES | N#CC1CN(C(=O)c2cc3cc(N)ccc3[nH]2)CCO1 |
| InChI | InChI=1S/C14H14N4O2/c15-7-11-8-18(3-4-20-11)14(19)13-6-9-5-10(16)1-2-12(9)17-13/h1-2,5-6,11,17H,3-4,8,16H2 |
| InChIKey | KEWJTSYTWVRVBH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|