About 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide
4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide (PubChem CID 79675699) has the molecular formula C11H19N5O3S
and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide.
Molecular Properties
| Compound Name | 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide |
| PubChem CID | 79675699 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1CN(S(=O)(=O)c2c(C)nn(C)c2C)CCO1 |
| InChI | InChI=1S/C11H19N5O3S/c1-7-10(8(2)15(3)14-7)20(17,18)16-4-5-19-9(6-16)11(12)13/h9H,4-6H2,1-3H3,(H3,12,13) |
| InChIKey | YQZCVTGZSFFVPX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide?
The IUPAC name of 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide (CID 79675699) is 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide.
What is the SMILES notation for 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide?
The canonical SMILES for 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide is [H]/N=C(\N)C1CN(S(=O)(=O)c2c(C)nn(C)c2C)CCO1.
What is the InChIKey of 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide?
The InChIKey is YQZCVTGZSFFVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O3S/c1-7-10(8(2)15(3)14-7)20(17,18)16-4-5-19-9(6-16)11(12)13/h9H,4-6H2,1-3H3,(H3,12,13).
What are the key properties of 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide?
4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide has a molecular weight of 301.37 g/mol, XLogP of -0.64, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholine-2-carboximidamide is sourced from PubChem (CID 79675699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).