C20H16FNO4 — CID 7967630
(5-phenyl-1,3-oxazol-2-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 7967630) has the molecular formula C20H16FNO4 and a molecular weight of 353.35 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7967630 |
| Molecular Formula | C20H16FNO4 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1)OCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H16FNO4/c21-16-8-6-14(7-9-16)17(23)10-11-20(24)25-13-19-22-12-18(26-19)15-4-2-1-3-5-15/h1-9,12H,10-11,13H2 |
| InChIKey | UNOQCTNHQVSRLL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |