C12H15F2NO3 — CID 79676471
3-(3,4-difluorophenyl)-N-(2-methoxyethoxy)propanamide (PubChem CID 79676471) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-(2-methoxyethoxy)propanamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-(2-methoxyethoxy)propanamide |
|---|---|
| PubChem CID | 79676471 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-(2-methoxyethoxy)propanamide |
| SMILES | COCCONC(=O)CCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H15F2NO3/c1-17-6-7-18-15-12(16)5-3-9-2-4-10(13)11(14)8-9/h2,4,8H,3,5-7H2,1H3,(H,15,16) |
| InChIKey | GRPYTXUSFILZHI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|