About 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide
2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide (PubChem CID 79676473) has the molecular formula C8H13N3O5
and a molecular weight of 231.21 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide.
Molecular Properties
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide |
| PubChem CID | 79676473 |
| Molecular Formula | C8H13N3O5 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide |
| SMILES | COCCONC(=O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C8H13N3O5/c1-15-2-3-16-10-6(12)5-11-7(13)4-9-8(11)14/h2-5H2,1H3,(H,9,14)(H,10,12) |
| InChIKey | FMXILIFNVZTUKI-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide?
The IUPAC name of 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide (CID 79676473) is 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide.
What is the SMILES notation for 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide?
The canonical SMILES for 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide is COCCONC(=O)CN1C(=O)CNC1=O.
What is the InChIKey of 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide?
The InChIKey is FMXILIFNVZTUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O5/c1-15-2-3-16-10-6(12)5-11-7(13)4-9-8(11)14/h2-5H2,1H3,(H,9,14)(H,10,12).
What are the key properties of 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide?
2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide has a molecular weight of 231.21 g/mol, XLogP of -1.77, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyethoxy)acetamide is sourced from PubChem (CID 79676473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).