C13H20N2 — CID 79676970
N-butan-2-yl-1,2,3,4-tetrahydroquinolin-7-amine (PubChem CID 79676970) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-butan-2-yl-1,2,3,4-tetrahydroquinolin-7-amine.
| Compound Name | N-butan-2-yl-1,2,3,4-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 79676970 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-butan-2-yl-1,2,3,4-tetrahydroquinolin-7-amine |
| SMILES | CCC(C)Nc1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C13H20N2/c1-3-10(2)15-12-7-6-11-5-4-8-14-13(11)9-12/h6-7,9-10,14-15H,3-5,8H2,1-2H3 |
| InChIKey | NCIIVLBEONMARA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |