About 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine
4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine (PubChem CID 79677475) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine |
| PubChem CID | 79677475 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCC(N2CC(OC)(OC)C2)CC1 |
| InChI | InChI=1S/C12H24N2O2/c1-13-10-4-6-11(7-5-10)14-8-12(9-14,15-2)16-3/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | IYKMMCTVYJUEHN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine?
The IUPAC name of 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine (CID 79677475) is 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine.
What is the SMILES notation for 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine?
The canonical SMILES for 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine is CNC1CCC(N2CC(OC)(OC)C2)CC1.
What is the InChIKey of 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine?
The InChIKey is IYKMMCTVYJUEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-13-10-4-6-11(7-5-10)14-8-12(9-14,15-2)16-3/h10-11,13H,4-9H2,1-3H3.
What are the key properties of 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine?
4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine has a molecular weight of 228.34 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethoxyazetidin-1-yl)-N-methylcyclohexan-1-amine is sourced from PubChem (CID 79677475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).