About 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine
2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine (PubChem CID 79677638) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine.
Molecular Properties
| Compound Name | 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine |
| PubChem CID | 79677638 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine |
| SMILES | COC1(OC)CN(CC2CCCCN2)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-14-11(15-2)8-13(9-11)7-10-5-3-4-6-12-10/h10,12H,3-9H2,1-2H3 |
| InChIKey | QOEPQCQTGLHBND-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine?
The IUPAC name of 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine (CID 79677638) is 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine.
What is the SMILES notation for 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine?
The canonical SMILES for 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine is COC1(OC)CN(CC2CCCCN2)C1.
What is the InChIKey of 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine?
The InChIKey is QOEPQCQTGLHBND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-14-11(15-2)8-13(9-11)7-10-5-3-4-6-12-10/h10,12H,3-9H2,1-2H3.
What are the key properties of 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine?
2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine has a molecular weight of 214.31 g/mol, XLogP of 0.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,3-dimethoxyazetidin-1-yl)methyl]piperidine is sourced from PubChem (CID 79677638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).