About 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine
7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine (PubChem CID 79677956) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine.
Molecular Properties
| Compound Name | 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
| PubChem CID | 79677956 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
| SMILES | CCN(CC)C1C(N)C2CCOC21 |
| InChI | InChI=1S/C10H20N2O/c1-3-12(4-2)9-8(11)7-5-6-13-10(7)9/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | BWFNTBUTVHWOAL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
The IUPAC name of 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine (CID 79677956) is 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine.
What is the SMILES notation for 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
The canonical SMILES for 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine is CCN(CC)C1C(N)C2CCOC21.
What is the InChIKey of 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
The InChIKey is BWFNTBUTVHWOAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-3-12(4-2)9-8(11)7-5-6-13-10(7)9/h7-10H,3-6,11H2,1-2H3.
What are the key properties of 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine has a molecular weight of 184.28 g/mol, XLogP of 0.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N,7-N-diethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine is sourced from PubChem (CID 79677956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).