C10H20N2O2 — CID 79678216
4-(3,3-dimethoxyazetidin-1-yl)piperidine (PubChem CID 79678216) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 4-(3,3-dimethoxyazetidin-1-yl)piperidine.
| Compound Name | 4-(3,3-dimethoxyazetidin-1-yl)piperidine |
|---|---|
| PubChem CID | 79678216 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 4-(3,3-dimethoxyazetidin-1-yl)piperidine |
| SMILES | COC1(OC)CN(C2CCNCC2)C1 |
| InChI | InChI=1S/C10H20N2O2/c1-13-10(14-2)7-12(8-10)9-3-5-11-6-4-9/h9,11H,3-8H2,1-2H3 |
| InChIKey | CPQSIVKCKDQWAW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|