C13H18N2 — CID 79679076
7-pyrrolidin-1-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 79679076) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 7-pyrrolidin-1-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-pyrrolidin-1-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 79679076 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 7-pyrrolidin-1-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1cc2c(cc1N1CCCC1)CNCC2 |
| InChI | InChI=1S/C13H18N2/c1-2-8-15(7-1)13-4-3-11-5-6-14-10-12(11)9-13/h3-4,9,14H,1-2,5-8,10H2 |
| InChIKey | WKLZNEXHHBPQLT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|