C14H32N2O — CID 79679402
N,N,2-trimethyl-1-[4-(2-methylpropylamino)butoxy]propan-2-amine (PubChem CID 79679402) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is N,N,2-trimethyl-1-[4-(2-methylpropylamino)butoxy]propan-2-amine.
| Compound Name | N,N,2-trimethyl-1-[4-(2-methylpropylamino)butoxy]propan-2-amine |
|---|---|
| PubChem CID | 79679402 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | N,N,2-trimethyl-1-[4-(2-methylpropylamino)butoxy]propan-2-amine |
| SMILES | CC(C)CNCCCCOCC(C)(C)N(C)C |
| InChI | InChI=1S/C14H32N2O/c1-13(2)11-15-9-7-8-10-17-12-14(3,4)16(5)6/h13,15H,7-12H2,1-6H3 |
| InChIKey | UFRLNYOPSPTJKN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|