C11H17NO2 — CID 79680066
4-(2-methylpyrrolidin-1-yl)cyclopent-2-ene-1-carboxylic acid (PubChem CID 79680066) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 4-(2-methylpyrrolidin-1-yl)cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-(2-methylpyrrolidin-1-yl)cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79680066 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 4-(2-methylpyrrolidin-1-yl)cyclopent-2-ene-1-carboxylic acid |
| SMILES | CC1CCCN1C1C=CC(C(=O)O)C1 |
| InChI | InChI=1S/C11H17NO2/c1-8-3-2-6-12(8)10-5-4-9(7-10)11(13)14/h4-5,8-10H,2-3,6-7H2,1H3,(H,13,14) |
| InChIKey | MDWWDQASAUELSL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|