C12H14Cl2N2OS — CID 79681122
4-[(2,6-dichlorophenyl)methyl]morpholine-2-carbothioamide (PubChem CID 79681122) has the molecular formula C12H14Cl2N2OS and a molecular weight of 305.23 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methyl]morpholine-2-carbothioamide.
| Compound Name | 4-[(2,6-dichlorophenyl)methyl]morpholine-2-carbothioamide |
|---|---|
| PubChem CID | 79681122 |
| Molecular Formula | C12H14Cl2N2OS |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methyl]morpholine-2-carbothioamide |
| SMILES | NC(=S)C1CN(Cc2c(Cl)cccc2Cl)CCO1 |
| InChI | InChI=1S/C12H14Cl2N2OS/c13-9-2-1-3-10(14)8(9)6-16-4-5-17-11(7-16)12(15)18/h1-3,11H,4-7H2,(H2,15,18) |
| InChIKey | ZSPQDYNCVPRTNX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|