About 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide
2-(2,3-dihydroxypropylsulfanyl)ethanimidamide (PubChem CID 79681850) has the molecular formula C5H12N2O2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide.
Molecular Properties
| Compound Name | 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide |
| PubChem CID | 79681850 |
| Molecular Formula | C5H12N2O2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide |
| SMILES | [H]/N=C(\N)CSCC(O)CO |
| InChI | InChI=1S/C5H12N2O2S/c6-5(7)3-10-2-4(9)1-8/h4,8-9H,1-3H2,(H3,6,7) |
| InChIKey | XOUKAANWTKNCAV-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide?
The IUPAC name of 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide (CID 79681850) is 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide.
What is the SMILES notation for 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide?
The canonical SMILES for 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide is [H]/N=C(\N)CSCC(O)CO.
What is the InChIKey of 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide?
The InChIKey is XOUKAANWTKNCAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2S/c6-5(7)3-10-2-4(9)1-8/h4,8-9H,1-3H2,(H3,6,7).
What are the key properties of 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide?
2-(2,3-dihydroxypropylsulfanyl)ethanimidamide has a molecular weight of 164.23 g/mol, XLogP of -0.99, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroxypropylsulfanyl)ethanimidamide is sourced from PubChem (CID 79681850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).