About 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide
2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide (PubChem CID 79682063) has the molecular formula C10H13FN2O2S
and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide |
| PubChem CID | 79682063 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1SCC(O)CO |
| InChI | InChI=1S/C10H13FN2O2S/c11-6-1-2-9(8(3-6)10(12)13)16-5-7(15)4-14/h1-3,7,14-15H,4-5H2,(H3,12,13) |
| InChIKey | NLHSHTHEDWQOJP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide?
The IUPAC name of 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide (CID 79682063) is 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide.
What is the SMILES notation for 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide?
The canonical SMILES for 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide is [H]/N=C(\N)c1cc(F)ccc1SCC(O)CO.
What is the InChIKey of 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide?
The InChIKey is NLHSHTHEDWQOJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN2O2S/c11-6-1-2-9(8(3-6)10(12)13)16-5-7(15)4-14/h1-3,7,14-15H,4-5H2,(H3,12,13).
What are the key properties of 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide?
2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide has a molecular weight of 244.29 g/mol, XLogP of 0.56, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroxypropylsulfanyl)-5-fluorobenzenecarboximidamide is sourced from PubChem (CID 79682063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).