C10H17N3O4S — CID 79682954
3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)sulfanylpropane-1,2-diol (PubChem CID 79682954) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is 3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79682954 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)sulfanylpropane-1,2-diol |
| SMILES | CCCc1nn(C)c(SCC(O)CO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H17N3O4S/c1-3-4-8-9(13(16)17)10(12(2)11-8)18-6-7(15)5-14/h7,14-15H,3-6H2,1-2H3 |
| InChIKey | MVMYWCOINVFWRD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|