About 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione
3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione (PubChem CID 79683003) has the molecular formula C8H14N2O4S
and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione |
| PubChem CID | 79683003 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCSCC(O)CO |
| InChI | InChI=1S/C8H14N2O4S/c11-4-6(12)5-15-2-1-10-7(13)3-9-8(10)14/h6,11-12H,1-5H2,(H,9,14) |
| InChIKey | QEBFDBADDKDRCF-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione?
The IUPAC name of 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione (CID 79683003) is 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione.
What is the SMILES notation for 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione?
The canonical SMILES for 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione is O=C1CNC(=O)N1CCSCC(O)CO.
What is the InChIKey of 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione?
The InChIKey is QEBFDBADDKDRCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O4S/c11-4-6(12)5-15-2-1-10-7(13)3-9-8(10)14/h6,11-12H,1-5H2,(H,9,14).
What are the key properties of 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione?
3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione has a molecular weight of 234.28 g/mol, XLogP of -1.38, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,3-dihydroxypropylsulfanyl)ethyl]imidazolidine-2,4-dione is sourced from PubChem (CID 79683003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).