About 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide
3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide (PubChem CID 79683109) has the molecular formula C8H17NO3S
and a molecular weight of 207.29 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide |
| PubChem CID | 79683109 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCSCC(O)CO |
| InChI | InChI=1S/C8H17NO3S/c1-9(2)8(12)3-4-13-6-7(11)5-10/h7,10-11H,3-6H2,1-2H3 |
| InChIKey | LVBTXRAMYPMHLR-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide?
The IUPAC name of 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide (CID 79683109) is 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide.
What is the SMILES notation for 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide?
The canonical SMILES for 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide is CN(C)C(=O)CCSCC(O)CO.
What is the InChIKey of 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide?
The InChIKey is LVBTXRAMYPMHLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3S/c1-9(2)8(12)3-4-13-6-7(11)5-10/h7,10-11H,3-6H2,1-2H3.
What are the key properties of 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide?
3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide has a molecular weight of 207.29 g/mol, XLogP of -0.45, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylpropanamide is sourced from PubChem (CID 79683109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).