C10H12IN3OS — CID 79683529
1-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]butan-2-amine (PubChem CID 79683529) has the molecular formula C10H12IN3OS and a molecular weight of 349.20 g/mol. Its IUPAC name is 1-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]butan-2-amine.
| Compound Name | 1-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]butan-2-amine |
|---|---|
| PubChem CID | 79683529 |
| Molecular Formula | C10H12IN3OS |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 1-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]butan-2-amine |
| SMILES | CCC(N)Cc1noc(-c2csc(I)c2)n1 |
| InChI | InChI=1S/C10H12IN3OS/c1-2-7(12)4-9-13-10(15-14-9)6-3-8(11)16-5-6/h3,5,7H,2,4,12H2,1H3 |
| InChIKey | WZMSLEMCAYQDMA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|