C15H13NO3S — CID 79683617
3-[4-[(3-methylphenyl)carbamoyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 79683617) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-[4-[(3-methylphenyl)carbamoyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[4-[(3-methylphenyl)carbamoyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79683617 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-[4-[(3-methylphenyl)carbamoyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | Cc1cccc(NC(=O)c2csc(C=CC(=O)O)c2)c1 |
| InChI | InChI=1S/C15H13NO3S/c1-10-3-2-4-12(7-10)16-15(19)11-8-13(20-9-11)5-6-14(17)18/h2-9H,1H3,(H,16,19)(H,17,18) |
| InChIKey | DWEFKFVLQLDZAV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|