5-(3,5-difluorophenyl)thiophene-3-carboxylic acid

C11H6F2O2S — CID 79683650

IUPAC5-(3,5-difluorophenyl)thiophene-3-carboxylic acid
SMILESO=C(O)c1csc(-c2cc(F)cc(F)c2)c1
InChIInChI=1S/C11H6F2O2S/c12-8-1-6(2-9(13)4-8)10-3-7(5-16-10)11(14)15/h1-5H,(H,14,15)
InChIKeyYTPBSVYKMAGYIV-UHFFFAOYSA-N
MW240.23 g/mol
LogP3.39
Rot. Bonds2

About 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid

5-(3,5-difluorophenyl)thiophene-3-carboxylic acid (PubChem CID 79683650) has the molecular formula C11H6F2O2S and a molecular weight of 240.23 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid.

Molecular Properties

Compound Name5-(3,5-difluorophenyl)thiophene-3-carboxylic acid
PubChem CID79683650
Molecular FormulaC11H6F2O2S
Molecular Weight240.23 g/mol
Exact Mass240.01
IUPAC Name5-(3,5-difluorophenyl)thiophene-3-carboxylic acid
SMILESO=C(O)c1csc(-c2cc(F)cc(F)c2)c1
InChIInChI=1S/C11H6F2O2S/c12-8-1-6(2-9(13)4-8)10-3-7(5-16-10)11(14)15/h1-5H,(H,14,15)
InChIKeyYTPBSVYKMAGYIV-UHFFFAOYSA-N
XLogP3.39
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.23
LogP ≤ 53.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid?
The IUPAC name of 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid (CID 79683650) is 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid.
What is the SMILES notation for 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid?
The canonical SMILES for 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid is O=C(O)c1csc(-c2cc(F)cc(F)c2)c1.
What is the InChIKey of 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid?
The InChIKey is YTPBSVYKMAGYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F2O2S/c12-8-1-6(2-9(13)4-8)10-3-7(5-16-10)11(14)15/h1-5H,(H,14,15).
What are the key properties of 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid?
5-(3,5-difluorophenyl)thiophene-3-carboxylic acid has a molecular weight of 240.23 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-difluorophenyl)thiophene-3-carboxylic acid is sourced from PubChem (CID 79683650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).