C11H14IN3O2S — CID 79683756
N-(3-amino-3-hydroxyiminopropyl)-N-cyclopropyl-5-iodothiophene-3-carboxamide (PubChem CID 79683756) has the molecular formula C11H14IN3O2S and a molecular weight of 379.22 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-N-cyclopropyl-5-iodothiophene-3-carboxamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-N-cyclopropyl-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79683756 |
| Molecular Formula | C11H14IN3O2S |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-N-cyclopropyl-5-iodothiophene-3-carboxamide |
| SMILES | NC(CCN(C(=O)c1csc(I)c1)C1CC1)=NO |
| InChI | InChI=1S/C11H14IN3O2S/c12-9-5-7(6-18-9)11(16)15(8-1-2-8)4-3-10(13)14-17/h5-6,8,17H,1-4H2,(H2,13,14) |
| InChIKey | NBKOXHZJAPAKOT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|