C13H16N2OS2 — CID 79684118
[5-(3-aminoprop-1-ynyl)thiophen-3-yl]-(3-methylthiomorpholin-4-yl)methanone (PubChem CID 79684118) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is [5-(3-aminoprop-1-ynyl)thiophen-3-yl]-(3-methylthiomorpholin-4-yl)methanone.
| Compound Name | [5-(3-aminoprop-1-ynyl)thiophen-3-yl]-(3-methylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 79684118 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | [5-(3-aminoprop-1-ynyl)thiophen-3-yl]-(3-methylthiomorpholin-4-yl)methanone |
| SMILES | CC1CSCCN1C(=O)c1csc(C#CCN)c1 |
| InChI | InChI=1S/C13H16N2OS2/c1-10-8-17-6-5-15(10)13(16)11-7-12(18-9-11)3-2-4-14/h7,9-10H,4-6,8,14H2,1H3 |
| InChIKey | SYEIBWGTKZVXMI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|