C16H19IOS — CID 79684536
(5-iodothiophen-3-yl)-(2,3,4,5,6-pentamethylphenyl)methanol (PubChem CID 79684536) has the molecular formula C16H19IOS and a molecular weight of 386.30 g/mol. Its IUPAC name is (5-iodothiophen-3-yl)-(2,3,4,5,6-pentamethylphenyl)methanol.
| Compound Name | (5-iodothiophen-3-yl)-(2,3,4,5,6-pentamethylphenyl)methanol |
|---|---|
| PubChem CID | 79684536 |
| Molecular Formula | C16H19IOS |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (5-iodothiophen-3-yl)-(2,3,4,5,6-pentamethylphenyl)methanol |
| SMILES | Cc1c(C)c(C)c(C(O)c2csc(I)c2)c(C)c1C |
| InChI | InChI=1S/C16H19IOS/c1-8-9(2)11(4)15(12(5)10(8)3)16(18)13-6-14(17)19-7-13/h6-7,16,18H,1-5H3 |
| InChIKey | VBYHLPKLSQKFBH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|