About 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide
1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide (PubChem CID 79685414) has the molecular formula C9H15N3O3S
and a molecular weight of 245.30 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide |
| PubChem CID | 79685414 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide |
| SMILES | Cc1cc(CS(=O)(=O)N[C@@H]2CCNC2)no1 |
| InChI | InChI=1S/C9H15N3O3S/c1-7-4-9(11-15-7)6-16(13,14)12-8-2-3-10-5-8/h4,8,10,12H,2-3,5-6H2,1H3/t8-/m1/s1 |
| InChIKey | YWFPRMQNCJHPLN-MRVPVSSYSA-N |
| XLogP | -0.24 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide?
The IUPAC name of 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide (CID 79685414) is 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide.
What is the SMILES notation for 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide?
The canonical SMILES for 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide is Cc1cc(CS(=O)(=O)N[C@@H]2CCNC2)no1.
What is the InChIKey of 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide?
The InChIKey is YWFPRMQNCJHPLN-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H15N3O3S/c1-7-4-9(11-15-7)6-16(13,14)12-8-2-3-10-5-8/h4,8,10,12H,2-3,5-6H2,1H3/t8-/m1/s1.
What are the key properties of 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide?
1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide has a molecular weight of 245.30 g/mol, XLogP of -0.24, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-1,2-oxazol-3-yl)-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide is sourced from PubChem (CID 79685414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).