C10H13N3O5S — CID 79686161
4-hydroxy-3-nitro-N-[(3R)-pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 79686161) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is 4-hydroxy-3-nitro-N-[(3R)-pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 4-hydroxy-3-nitro-N-[(3R)-pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 79686161 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-hydroxy-3-nitro-N-[(3R)-pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N[C@@H]2CCNC2)ccc1O |
| InChI | InChI=1S/C10H13N3O5S/c14-10-2-1-8(5-9(10)13(15)16)19(17,18)12-7-3-4-11-6-7/h1-2,5,7,11-12,14H,3-4,6H2/t7-/m1/s1 |
| InChIKey | QEJFNLZSFIBZNF-SSDOTTSWSA-N |
| XLogP | -0.06 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|