About [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine
[5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine (PubChem CID 79686695) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine |
| PubChem CID | 79686695 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine |
| SMILES | Cc1ccc(C)n1-c1c(CN)cnn1C |
| InChI | InChI=1S/C11H16N4/c1-8-4-5-9(2)15(8)11-10(6-12)7-13-14(11)3/h4-5,7H,6,12H2,1-3H3 |
| InChIKey | JTLSSFBARFKBEF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine?
The IUPAC name of [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine (CID 79686695) is [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine.
What is the SMILES notation for [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine?
The canonical SMILES for [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine is Cc1ccc(C)n1-c1c(CN)cnn1C.
What is the InChIKey of [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine?
The InChIKey is JTLSSFBARFKBEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-8-4-5-9(2)15(8)11-10(6-12)7-13-14(11)3/h4-5,7H,6,12H2,1-3H3.
What are the key properties of [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine?
[5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine has a molecular weight of 204.28 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazol-4-yl]methanamine is sourced from PubChem (CID 79686695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).