C11H18N2O2 — CID 79687199
2-(3,3-dimethoxyazetidin-1-yl)cyclopentane-1-carbonitrile (PubChem CID 79687199) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(3,3-dimethoxyazetidin-1-yl)cyclopentane-1-carbonitrile.
| Compound Name | 2-(3,3-dimethoxyazetidin-1-yl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79687199 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(3,3-dimethoxyazetidin-1-yl)cyclopentane-1-carbonitrile |
| SMILES | COC1(OC)CN(C2CCCC2C#N)C1 |
| InChI | InChI=1S/C11H18N2O2/c1-14-11(15-2)7-13(8-11)10-5-3-4-9(10)6-12/h9-10H,3-5,7-8H2,1-2H3 |
| InChIKey | XJOGPLAKYBZGPM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|