About 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile
2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile (PubChem CID 79687276) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile |
| PubChem CID | 79687276 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile |
| SMILES | N#Cc1ccccc1N1CCCOC1=O |
| InChI | InChI=1S/C11H10N2O2/c12-8-9-4-1-2-5-10(9)13-6-3-7-15-11(13)14/h1-2,4-5H,3,6-7H2 |
| InChIKey | JEKQTBCZRKIUON-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile?
The IUPAC name of 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile (CID 79687276) is 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile.
What is the SMILES notation for 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile?
The canonical SMILES for 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile is N#Cc1ccccc1N1CCCOC1=O.
What is the InChIKey of 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile?
The InChIKey is JEKQTBCZRKIUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c12-8-9-4-1-2-5-10(9)13-6-3-7-15-11(13)14/h1-2,4-5H,3,6-7H2.
What are the key properties of 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile?
2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile has a molecular weight of 202.21 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-1,3-oxazinan-3-yl)benzonitrile is sourced from PubChem (CID 79687276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).