About (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide
(4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide (PubChem CID 796894) has the molecular formula C19H21N3O3
and a molecular weight of 339.40 g/mol. Its IUPAC name is (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide.
Molecular Properties
| Compound Name | (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide |
| PubChem CID | 796894 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide |
| SMILES | CCN(CC)C(=O)[C@]1(O)c2ccccc2NC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C19H21N3O3/c1-3-21(4-2)17(23)19(25)15-12-8-9-13-16(15)20-18(24)22(19)14-10-6-5-7-11-14/h5-13,25H,3-4H2,1-2H3,(H,20,24)/t19-/m1/s1 |
| InChIKey | FTEBASPSRWPPER-LJQANCHMSA-N |
| XLogP | 2.75 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide?
The IUPAC name of (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide (CID 796894) is (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide.
What is the SMILES notation for (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide?
The canonical SMILES for (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide is CCN(CC)C(=O)[C@]1(O)c2ccccc2NC(=O)N1c1ccccc1.
What is the InChIKey of (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide?
The InChIKey is FTEBASPSRWPPER-LJQANCHMSA-N. The full InChI is InChI=1S/C19H21N3O3/c1-3-21(4-2)17(23)19(25)15-12-8-9-13-16(15)20-18(24)22(19)14-10-6-5-7-11-14/h5-13,25H,3-4H2,1-2H3,(H,20,24)/t19-/m1/s1.
What are the key properties of (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide?
(4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide has a molecular weight of 339.40 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-N,N-diethyl-4-hydroxy-2-oxo-3-phenyl-1H-quinazoline-4-carboxamide is sourced from PubChem (CID 796894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).