C11H21NO3 — CID 79689744
3-(3-tert-butylazetidin-1-yl)-2-hydroxy-2-methylpropanoic acid (PubChem CID 79689744) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 3-(3-tert-butylazetidin-1-yl)-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-(3-tert-butylazetidin-1-yl)-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79689744 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 3-(3-tert-butylazetidin-1-yl)-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CN1CC(C(C)(C)C)C1)C(=O)O |
| InChI | InChI=1S/C11H21NO3/c1-10(2,3)8-5-12(6-8)7-11(4,15)9(13)14/h8,15H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | MFROWONFTBLLBL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |