C14H14INO3S2 — CID 79691498
ethyl 2-[(5-iodothiophene-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 79691498) has the molecular formula C14H14INO3S2 and a molecular weight of 435.31 g/mol. Its IUPAC name is ethyl 2-[(5-iodothiophene-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-iodothiophene-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 79691498 |
| Molecular Formula | C14H14INO3S2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.95 |
| IUPAC Name | ethyl 2-[(5-iodothiophene-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2csc(I)c2)sc(C)c1C |
| InChI | InChI=1S/C14H14INO3S2/c1-4-19-14(18)11-7(2)8(3)21-13(11)16-12(17)9-5-10(15)20-6-9/h5-6H,4H2,1-3H3,(H,16,17) |
| InChIKey | LHLPRJDELUKABX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|