C15H16FIN2OS — CID 79691661
N-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-5-iodothiophene-3-carboxamide (PubChem CID 79691661) has the molecular formula C15H16FIN2OS and a molecular weight of 418.28 g/mol. Its IUPAC name is N-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-5-iodothiophene-3-carboxamide.
| Compound Name | N-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79691661 |
| Molecular Formula | C15H16FIN2OS |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | N-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-5-iodothiophene-3-carboxamide |
| SMILES | CC(C)N(C)c1ccc(NC(=O)c2csc(I)c2)cc1F |
| InChI | InChI=1S/C15H16FIN2OS/c1-9(2)19(3)13-5-4-11(7-12(13)16)18-15(20)10-6-14(17)21-8-10/h4-9H,1-3H3,(H,18,20) |
| InChIKey | MGCVZGYZLLISNQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|