C16H13N3OS — CID 79691893
5-(3-aminoprop-1-ynyl)-N-(3-cyanophenyl)-N-methylthiophene-3-carboxamide (PubChem CID 79691893) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-N-(3-cyanophenyl)-N-methylthiophene-3-carboxamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-N-(3-cyanophenyl)-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 79691893 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-N-(3-cyanophenyl)-N-methylthiophene-3-carboxamide |
| SMILES | CN(C(=O)c1csc(C#CCN)c1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H13N3OS/c1-19(14-5-2-4-12(8-14)10-18)16(20)13-9-15(21-11-13)6-3-7-17/h2,4-5,8-9,11H,7,17H2,1H3 |
| InChIKey | FKGMTFVQPWYURH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|