C11H7Cl2IN2OS — CID 79692769
N-(3,5-dichloro-6-methyl-2-pyridinyl)-5-iodothiophene-3-carboxamide (PubChem CID 79692769) has the molecular formula C11H7Cl2IN2OS and a molecular weight of 413.07 g/mol. Its IUPAC name is N-(3,5-dichloro-6-methyl-2-pyridinyl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(3,5-dichloro-6-methyl-2-pyridinyl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79692769 |
| Molecular Formula | C11H7Cl2IN2OS |
| Molecular Weight | 413.07 g/mol |
| Exact Mass | 411.87 |
| IUPAC Name | N-(3,5-dichloro-6-methyl-2-pyridinyl)-5-iodothiophene-3-carboxamide |
| SMILES | Cc1nc(NC(=O)c2csc(I)c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H7Cl2IN2OS/c1-5-7(12)3-8(13)10(15-5)16-11(17)6-2-9(14)18-4-6/h2-4H,1H3,(H,15,16,17) |
| InChIKey | DARDEYZPTOYJOL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.07 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|