C6H4IN3S2 — CID 79693896
5-(5-iodothiophen-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 79693896) has the molecular formula C6H4IN3S2 and a molecular weight of 309.16 g/mol. Its IUPAC name is 5-(5-iodothiophen-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(5-iodothiophen-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 79693896 |
| Molecular Formula | C6H4IN3S2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.89 |
| IUPAC Name | 5-(5-iodothiophen-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2csc(I)c2)[nH][nH]1 |
| InChI | InChI=1S/C6H4IN3S2/c7-4-1-3(2-12-4)5-8-6(11)10-9-5/h1-2H,(H2,8,9,10,11) |
| InChIKey | PVZMDNNOYHUBCW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|