4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid

C16H31NO2 — CID 79694273

IUPAC4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid
SMILESCCC1(CC)CN(CCC(CCC(=O)O)C(C)C)C1
InChIInChI=1S/C16H31NO2/c1-5-16(6-2)11-17(12-16)10-9-14(13(3)4)7-8-15(18)19/h13-14H,5-12H2,1-4H3,(H,18,19)
InChIKeyQGEJQJRHALAODB-UHFFFAOYSA-N
MW269.43 g/mol
LogP3.64
Rot. Bonds9

About 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid

4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid (PubChem CID 79694273) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid.

Molecular Properties

Compound Name4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid
PubChem CID79694273
Molecular FormulaC16H31NO2
Molecular Weight269.43 g/mol
Exact Mass269.24
IUPAC Name4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid
SMILESCCC1(CC)CN(CCC(CCC(=O)O)C(C)C)C1
InChIInChI=1S/C16H31NO2/c1-5-16(6-2)11-17(12-16)10-9-14(13(3)4)7-8-15(18)19/h13-14H,5-12H2,1-4H3,(H,18,19)
InChIKeyQGEJQJRHALAODB-UHFFFAOYSA-N
XLogP3.64
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.43
LogP ≤ 53.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid?
The IUPAC name of 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid (CID 79694273) is 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid.
What is the SMILES notation for 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid?
The canonical SMILES for 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid is CCC1(CC)CN(CCC(CCC(=O)O)C(C)C)C1.
What is the InChIKey of 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid?
The InChIKey is QGEJQJRHALAODB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO2/c1-5-16(6-2)11-17(12-16)10-9-14(13(3)4)7-8-15(18)19/h13-14H,5-12H2,1-4H3,(H,18,19).
What are the key properties of 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid?
4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid has a molecular weight of 269.43 g/mol, XLogP of 3.64, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,3-diethylazetidin-1-yl)ethyl]-5-methylhexanoic acid is sourced from PubChem (CID 79694273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).