C14H9ClF2O2 — CID 79697438
(4-chloro-3-methoxyphenyl)-(2,6-difluorophenyl)methanone (PubChem CID 79697438) has the molecular formula C14H9ClF2O2 and a molecular weight of 282.67 g/mol. Its IUPAC name is (4-chloro-3-methoxyphenyl)-(2,6-difluorophenyl)methanone.
| Compound Name | (4-chloro-3-methoxyphenyl)-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 79697438 |
| Molecular Formula | C14H9ClF2O2 |
| Molecular Weight | 282.67 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (4-chloro-3-methoxyphenyl)-(2,6-difluorophenyl)methanone |
| SMILES | COc1cc(C(=O)c2c(F)cccc2F)ccc1Cl |
| InChI | InChI=1S/C14H9ClF2O2/c1-19-12-7-8(5-6-9(12)15)14(18)13-10(16)3-2-4-11(13)17/h2-7H,1H3 |
| InChIKey | XLUQJZPPDMTORB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |