C18H22FNS — CID 79697557
N-ethyl-1-(3-fluoro-5-methylphenyl)-2-(3-methylphenyl)sulfanylethanamine (PubChem CID 79697557) has the molecular formula C18H22FNS and a molecular weight of 303.45 g/mol. Its IUPAC name is N-ethyl-1-(3-fluoro-5-methylphenyl)-2-(3-methylphenyl)sulfanylethanamine.
| Compound Name | N-ethyl-1-(3-fluoro-5-methylphenyl)-2-(3-methylphenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 79697557 |
| Molecular Formula | C18H22FNS |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-ethyl-1-(3-fluoro-5-methylphenyl)-2-(3-methylphenyl)sulfanylethanamine |
| SMILES | CCNC(CSc1cccc(C)c1)c1cc(C)cc(F)c1 |
| InChI | InChI=1S/C18H22FNS/c1-4-20-18(15-8-14(3)9-16(19)11-15)12-21-17-7-5-6-13(2)10-17/h5-11,18,20H,4,12H2,1-3H3 |
| InChIKey | UCGSGMKAGJVJKF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |